C25H36N4O3 — CID 45370592
N-(2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-ylmethyl)-4-oxo-4-(6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-11-yl)butanamide (PubChem CID 45370592) has the molecular formula C25H36N4O3 and a molecular weight of 440.59 g/mol. Its IUPAC name is N-(2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-ylmethyl)-4-oxo-4-(6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-11-yl)butanamide.
| Compound Name | N-(2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-ylmethyl)-4-oxo-4-(6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-11-yl)butanamide |
|---|---|
| PubChem CID | 45370592 |
| Molecular Formula | C25H36N4O3 |
| Molecular Weight | 440.59 g/mol |
| Exact Mass | 440.28 |
| IUPAC Name | N-(2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-ylmethyl)-4-oxo-4-(6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-11-yl)butanamide |
| SMILES | O=C(CCC(=O)N1CC2CC(C1)c1cccc(=O)n1C2)NCC1CCCN2CCCCC12 |
| InChI | InChI=1S/C25H36N4O3/c30-23(26-14-19-5-4-12-27-11-2-1-6-21(19)27)9-10-24(31)28-15-18-13-20(17-28)22-7-3-8-25(32)29(22)16-18/h3,7-8,18-21H,1-2,4-6,9-17H2,(H,26,30) |
| InChIKey | GHPGYLQPBJKRLB-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 74.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.59 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |