C23H25N3O5S — CID 45370828
N-(4-acetamidophenyl)-6,7-dimethoxy-2,2-dimethyl-5-oxo-3,9b-dihydro-[1,3]thiazolo[2,3-a]isoindole-3-carboxamide (PubChem CID 45370828) has the molecular formula C23H25N3O5S and a molecular weight of 455.54 g/mol. Its IUPAC name is N-(4-acetamidophenyl)-6,7-dimethoxy-2,2-dimethyl-5-oxo-3,9b-dihydro-[1,3]thiazolo[2,3-a]isoindole-3-carboxamide.
| Compound Name | N-(4-acetamidophenyl)-6,7-dimethoxy-2,2-dimethyl-5-oxo-3,9b-dihydro-[1,3]thiazolo[2,3-a]isoindole-3-carboxamide |
|---|---|
| PubChem CID | 45370828 |
| Molecular Formula | C23H25N3O5S |
| Molecular Weight | 455.54 g/mol |
| Exact Mass | 455.15 |
| IUPAC Name | N-(4-acetamidophenyl)-6,7-dimethoxy-2,2-dimethyl-5-oxo-3,9b-dihydro-[1,3]thiazolo[2,3-a]isoindole-3-carboxamide |
| SMILES | COc1ccc2c(c1OC)C(=O)N1C2SC(C)(C)C1C(=O)Nc1ccc(NC(C)=O)cc1 |
| InChI | InChI=1S/C23H25N3O5S/c1-12(27)24-13-6-8-14(9-7-13)25-20(28)19-23(2,3)32-22-15-10-11-16(30-4)18(31-5)17(15)21(29)26(19)22/h6-11,19,22H,1-5H3,(H,24,27)(H,25,28) |
| InChIKey | ALDPOLDRPUBIDH-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.54 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |