C25H28FN3O5 — CID 45371178
N-(2-fluorophenyl)-3-[1-[[4-(4-methoxyphenyl)oxan-4-yl]methyl]-2,5-dioxoimidazolidin-4-yl]propanamide (PubChem CID 45371178) has the molecular formula C25H28FN3O5 and a molecular weight of 469.51 g/mol. Its IUPAC name is N-(2-fluorophenyl)-3-[1-[[4-(4-methoxyphenyl)oxan-4-yl]methyl]-2,5-dioxoimidazolidin-4-yl]propanamide.
| Compound Name | N-(2-fluorophenyl)-3-[1-[[4-(4-methoxyphenyl)oxan-4-yl]methyl]-2,5-dioxoimidazolidin-4-yl]propanamide |
|---|---|
| PubChem CID | 45371178 |
| Molecular Formula | C25H28FN3O5 |
| Molecular Weight | 469.51 g/mol |
| Exact Mass | 469.20 |
| IUPAC Name | N-(2-fluorophenyl)-3-[1-[[4-(4-methoxyphenyl)oxan-4-yl]methyl]-2,5-dioxoimidazolidin-4-yl]propanamide |
| SMILES | COc1ccc(C2(CN3C(=O)NC(CCC(=O)Nc4ccccc4F)C3=O)CCOCC2)cc1 |
| InChI | InChI=1S/C25H28FN3O5/c1-33-18-8-6-17(7-9-18)25(12-14-34-15-13-25)16-29-23(31)21(28-24(29)32)10-11-22(30)27-20-5-3-2-4-19(20)26/h2-9,21H,10-16H2,1H3,(H,27,30)(H,28,32) |
| InChIKey | MZEUDGOZDSQUGW-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.51 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|