C20H20BrNO2 — CID 45371614
[1-[4-[(4-bromophenyl)methoxy]phenyl]-2,5-dimethylpyrrol-3-yl]methanol (PubChem CID 45371614) has the molecular formula C20H20BrNO2 and a molecular weight of 386.29 g/mol. Its IUPAC name is [1-[4-[(4-bromophenyl)methoxy]phenyl]-2,5-dimethylpyrrol-3-yl]methanol.
| Compound Name | [1-[4-[(4-bromophenyl)methoxy]phenyl]-2,5-dimethylpyrrol-3-yl]methanol |
|---|---|
| PubChem CID | 45371614 |
| Molecular Formula | C20H20BrNO2 |
| Molecular Weight | 386.29 g/mol |
| Exact Mass | 385.07 |
| IUPAC Name | [1-[4-[(4-bromophenyl)methoxy]phenyl]-2,5-dimethylpyrrol-3-yl]methanol |
| SMILES | Cc1cc(CO)c(C)n1-c1ccc(OCc2ccc(Br)cc2)cc1 |
| InChI | InChI=1S/C20H20BrNO2/c1-14-11-17(12-23)15(2)22(14)19-7-9-20(10-8-19)24-13-16-3-5-18(21)6-4-16/h3-11,23H,12-13H2,1-2H3 |
| InChIKey | PVWIWEFTNQCCEI-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 34.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.29 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|