C19H23BrN2O3S — CID 45371881
2-[(4-bromophenyl)sulfonyl-ethylamino]-N-(2-ethyl-6-methylphenyl)acetamide (PubChem CID 45371881) has the molecular formula C19H23BrN2O3S and a molecular weight of 439.38 g/mol. Its IUPAC name is 2-[(4-bromophenyl)sulfonyl-ethylamino]-N-(2-ethyl-6-methylphenyl)acetamide.
| Compound Name | 2-[(4-bromophenyl)sulfonyl-ethylamino]-N-(2-ethyl-6-methylphenyl)acetamide |
|---|---|
| PubChem CID | 45371881 |
| Molecular Formula | C19H23BrN2O3S |
| Molecular Weight | 439.38 g/mol |
| Exact Mass | 438.06 |
| IUPAC Name | 2-[(4-bromophenyl)sulfonyl-ethylamino]-N-(2-ethyl-6-methylphenyl)acetamide |
| SMILES | CCc1cccc(C)c1NC(=O)CN(CC)S(=O)(=O)c1ccc(Br)cc1 |
| InChI | InChI=1S/C19H23BrN2O3S/c1-4-15-8-6-7-14(3)19(15)21-18(23)13-22(5-2)26(24,25)17-11-9-16(20)10-12-17/h6-12H,4-5,13H2,1-3H3,(H,21,23) |
| InChIKey | FPHGMKKYYRDFCC-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.38 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |