C16H18ClN3O6S2 — CID 45373358
2-[(5-chloro-2-methoxyphenyl)sulfonyl-methylamino]-N-(4-sulfamoylphenyl)acetamide (PubChem CID 45373358) has the molecular formula C16H18ClN3O6S2 and a molecular weight of 447.92 g/mol. Its IUPAC name is 2-[(5-chloro-2-methoxyphenyl)sulfonyl-methylamino]-N-(4-sulfamoylphenyl)acetamide.
| Compound Name | 2-[(5-chloro-2-methoxyphenyl)sulfonyl-methylamino]-N-(4-sulfamoylphenyl)acetamide |
|---|---|
| PubChem CID | 45373358 |
| Molecular Formula | C16H18ClN3O6S2 |
| Molecular Weight | 447.92 g/mol |
| Exact Mass | 447.03 |
| IUPAC Name | 2-[(5-chloro-2-methoxyphenyl)sulfonyl-methylamino]-N-(4-sulfamoylphenyl)acetamide |
| SMILES | COc1ccc(Cl)cc1S(=O)(=O)N(C)CC(=O)Nc1ccc(S(N)(=O)=O)cc1 |
| InChI | InChI=1S/C16H18ClN3O6S2/c1-20(28(24,25)15-9-11(17)3-8-14(15)26-2)10-16(21)19-12-4-6-13(7-5-12)27(18,22)23/h3-9H,10H2,1-2H3,(H,19,21)(H2,18,22,23) |
| InChIKey | ZTMYIHDMSYLUQZ-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 135.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.92 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |