C13H15N3O3S — CID 4537458
N-(3,4-dimethoxyphenyl)-2-(2-imino-1,3-thiazol-3-yl)acetamide (PubChem CID 4537458) has the molecular formula C13H15N3O3S and a molecular weight of 293.35 g/mol. Its IUPAC name is N-(3,4-dimethoxyphenyl)-2-(2-imino-1,3-thiazol-3-yl)acetamide.
| Compound Name | N-(3,4-dimethoxyphenyl)-2-(2-imino-1,3-thiazol-3-yl)acetamide |
|---|---|
| PubChem CID | 4537458 |
| Molecular Formula | C13H15N3O3S |
| Molecular Weight | 293.35 g/mol |
| Exact Mass | 293.08 |
| IUPAC Name | N-(3,4-dimethoxyphenyl)-2-(2-imino-1,3-thiazol-3-yl)acetamide |
| SMILES | [H]/N=c1\sccn1CC(=O)Nc1ccc(OC)c(OC)c1 |
| InChI | InChI=1S/C13H15N3O3S/c1-18-10-4-3-9(7-11(10)19-2)15-12(17)8-16-5-6-20-13(16)14/h3-7,14H,8H2,1-2H3,(H,15,17)/b14-13- |
| InChIKey | LYCRKJRLFHEPBA-YPKPFQOOSA-N |
| XLogP | 1.68 |
| TPSA | 76.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.35 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |