C24H28N4O3 — CID 45376292
(5R)-3-[[6-[1-(cyclopropylmethyl)piperidin-4-yl]oxy-3-pyridinyl]methyl]-5-phenylimidazolidine-2,4-dione (PubChem CID 45376292) has the molecular formula C24H28N4O3 and a molecular weight of 420.51 g/mol. Its IUPAC name is (5R)-3-[[6-[1-(cyclopropylmethyl)piperidin-4-yl]oxy-3-pyridinyl]methyl]-5-phenylimidazolidine-2,4-dione.
| Compound Name | (5R)-3-[[6-[1-(cyclopropylmethyl)piperidin-4-yl]oxy-3-pyridinyl]methyl]-5-phenylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 45376292 |
| Molecular Formula | C24H28N4O3 |
| Molecular Weight | 420.51 g/mol |
| Exact Mass | 420.22 |
| IUPAC Name | (5R)-3-[[6-[1-(cyclopropylmethyl)piperidin-4-yl]oxy-3-pyridinyl]methyl]-5-phenylimidazolidine-2,4-dione |
| SMILES | O=C1N[C@H](c2ccccc2)C(=O)N1Cc1ccc(OC2CCN(CC3CC3)CC2)nc1 |
| InChI | InChI=1S/C24H28N4O3/c29-23-22(19-4-2-1-3-5-19)26-24(30)28(23)16-18-8-9-21(25-14-18)31-20-10-12-27(13-11-20)15-17-6-7-17/h1-5,8-9,14,17,20,22H,6-7,10-13,15-16H2,(H,26,30)/t22-/m1/s1 |
| InChIKey | PJLJAMRTQZLGSB-JOCHJYFZSA-N |
| XLogP | 3.13 |
| TPSA | 74.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.51 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|