C21H21BrFN5O — CID 45376447
5-bromo-N-[(4-fluorophenyl)methyl]-8-(piperidin-4-ylamino)-1,6-naphthyridine-7-carboxamide (PubChem CID 45376447) has the molecular formula C21H21BrFN5O and a molecular weight of 458.34 g/mol. Its IUPAC name is 5-bromo-N-[(4-fluorophenyl)methyl]-8-(piperidin-4-ylamino)-1,6-naphthyridine-7-carboxamide.
| Compound Name | 5-bromo-N-[(4-fluorophenyl)methyl]-8-(piperidin-4-ylamino)-1,6-naphthyridine-7-carboxamide |
|---|---|
| PubChem CID | 45376447 |
| Molecular Formula | C21H21BrFN5O |
| Molecular Weight | 458.34 g/mol |
| Exact Mass | 457.09 |
| IUPAC Name | 5-bromo-N-[(4-fluorophenyl)methyl]-8-(piperidin-4-ylamino)-1,6-naphthyridine-7-carboxamide |
| SMILES | O=C(NCc1ccc(F)cc1)c1nc(Br)c2cccnc2c1NC1CCNCC1 |
| InChI | InChI=1S/C21H21BrFN5O/c22-20-16-2-1-9-25-17(16)18(27-15-7-10-24-11-8-15)19(28-20)21(29)26-12-13-3-5-14(23)6-4-13/h1-6,9,15,24,27H,7-8,10-12H2,(H,26,29) |
| InChIKey | IGJYNUHXOFRDGF-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 78.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.34 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|