About 3-bromo-6-(4-methylpiperazin-1-yl)-11H-benzo[b][4,1]benzazaphosphepine
3-bromo-6-(4-methylpiperazin-1-yl)-11H-benzo[b][4,1]benzazaphosphepine (PubChem CID 45376464) has the molecular formula C18H19BrN3P
and a molecular weight of 388.25 g/mol. Its IUPAC name is 3-bromo-6-(4-methylpiperazin-1-yl)-11H-benzo[b][4,1]benzazaphosphepine.
Molecular Properties
| Compound Name | 3-bromo-6-(4-methylpiperazin-1-yl)-11H-benzo[b][4,1]benzazaphosphepine |
| PubChem CID | 45376464 |
| Molecular Formula | C18H19BrN3P |
| Molecular Weight | 388.25 g/mol |
| Exact Mass | 387.05 |
| IUPAC Name | 3-bromo-6-(4-methylpiperazin-1-yl)-11H-benzo[b][4,1]benzazaphosphepine |
| SMILES | CN1CCN(C2=Nc3cc(Br)ccc3Pc3ccccc32)CC1 |
| InChI | InChI=1S/C18H19BrN3P/c1-21-8-10-22(11-9-21)18-14-4-2-3-5-16(14)23-17-7-6-13(19)12-15(17)20-18/h2-7,12,23H,8-11H2,1H3 |
| InChIKey | FUMCIRKLOQDBMP-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 18.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 388.25 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 3-bromo-6-(4-methylpiperazin-1-yl)-11H-benzo[b][4,1]benzazaphosphepine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-bromo-6-(4-methylpiperazin-1-yl)-11H-benzo[b][4,1]benzazaphosphepine?
The IUPAC name of 3-bromo-6-(4-methylpiperazin-1-yl)-11H-benzo[b][4,1]benzazaphosphepine (CID 45376464) is 3-bromo-6-(4-methylpiperazin-1-yl)-11H-benzo[b][4,1]benzazaphosphepine.
What is the SMILES notation for 3-bromo-6-(4-methylpiperazin-1-yl)-11H-benzo[b][4,1]benzazaphosphepine?
The canonical SMILES for 3-bromo-6-(4-methylpiperazin-1-yl)-11H-benzo[b][4,1]benzazaphosphepine is CN1CCN(C2=Nc3cc(Br)ccc3Pc3ccccc32)CC1.
What is the InChIKey of 3-bromo-6-(4-methylpiperazin-1-yl)-11H-benzo[b][4,1]benzazaphosphepine?
The InChIKey is FUMCIRKLOQDBMP-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H19BrN3P/c1-21-8-10-22(11-9-21)18-14-4-2-3-5-16(14)23-17-7-6-13(19)12-15(17)20-18/h2-7,12,23H,8-11H2,1H3.
What are the key properties of 3-bromo-6-(4-methylpiperazin-1-yl)-11H-benzo[b][4,1]benzazaphosphepine?
3-bromo-6-(4-methylpiperazin-1-yl)-11H-benzo[b][4,1]benzazaphosphepine has a molecular weight of 388.25 g/mol, XLogP of 2.72, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-bromo-6-(4-methylpiperazin-1-yl)-11H-benzo[b][4,1]benzazaphosphepine is sourced from PubChem (CID 45376464), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).