About 3-[[[2-(6-phenyl-1,3-benzothiazol-2-yl)acetyl]amino]methyl]benzoic acid
3-[[[2-(6-phenyl-1,3-benzothiazol-2-yl)acetyl]amino]methyl]benzoic acid (PubChem CID 45376635) has the molecular formula C23H18N2O3S
and a molecular weight of 402.48 g/mol. Its IUPAC name is 3-[[[2-(6-phenyl-1,3-benzothiazol-2-yl)acetyl]amino]methyl]benzoic acid.
Molecular Properties
| Compound Name | 3-[[[2-(6-phenyl-1,3-benzothiazol-2-yl)acetyl]amino]methyl]benzoic acid |
| PubChem CID | 45376635 |
| Molecular Formula | C23H18N2O3S |
| Molecular Weight | 402.48 g/mol |
| Exact Mass | 402.10 |
| IUPAC Name | 3-[[[2-(6-phenyl-1,3-benzothiazol-2-yl)acetyl]amino]methyl]benzoic acid |
| SMILES | O=C(Cc1nc2ccc(-c3ccccc3)cc2s1)NCc1cccc(C(=O)O)c1 |
| InChI | InChI=1S/C23H18N2O3S/c26-21(24-14-15-5-4-8-18(11-15)23(27)28)13-22-25-19-10-9-17(12-20(19)29-22)16-6-2-1-3-7-16/h1-12H,13-14H2,(H,24,26)(H,27,28) |
| InChIKey | MCMPPHVKCGQGIT-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 79.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 402.48 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-[[[2-(6-phenyl-1,3-benzothiazol-2-yl)acetyl]amino]methyl]benzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[[[2-(6-phenyl-1,3-benzothiazol-2-yl)acetyl]amino]methyl]benzoic acid?
The IUPAC name of 3-[[[2-(6-phenyl-1,3-benzothiazol-2-yl)acetyl]amino]methyl]benzoic acid (CID 45376635) is 3-[[[2-(6-phenyl-1,3-benzothiazol-2-yl)acetyl]amino]methyl]benzoic acid.
What is the SMILES notation for 3-[[[2-(6-phenyl-1,3-benzothiazol-2-yl)acetyl]amino]methyl]benzoic acid?
The canonical SMILES for 3-[[[2-(6-phenyl-1,3-benzothiazol-2-yl)acetyl]amino]methyl]benzoic acid is O=C(Cc1nc2ccc(-c3ccccc3)cc2s1)NCc1cccc(C(=O)O)c1.
What is the InChIKey of 3-[[[2-(6-phenyl-1,3-benzothiazol-2-yl)acetyl]amino]methyl]benzoic acid?
The InChIKey is MCMPPHVKCGQGIT-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H18N2O3S/c26-21(24-14-15-5-4-8-18(11-15)23(27)28)13-22-25-19-10-9-17(12-20(19)29-22)16-6-2-1-3-7-16/h1-12H,13-14H2,(H,24,26)(H,27,28).
What are the key properties of 3-[[[2-(6-phenyl-1,3-benzothiazol-2-yl)acetyl]amino]methyl]benzoic acid?
3-[[[2-(6-phenyl-1,3-benzothiazol-2-yl)acetyl]amino]methyl]benzoic acid has a molecular weight of 402.48 g/mol, XLogP of 4.52, 6 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[[[2-(6-phenyl-1,3-benzothiazol-2-yl)acetyl]amino]methyl]benzoic acid is sourced from PubChem (CID 45376635), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).