About tert-butyl 3-amino-5-[2-(4-ethylpiperazin-1-yl)ethoxy]-4,6-dimethylthieno[2,3-b]pyridine-2-carboxylate
tert-butyl 3-amino-5-[2-(4-ethylpiperazin-1-yl)ethoxy]-4,6-dimethylthieno[2,3-b]pyridine-2-carboxylate (PubChem CID 45376736) has the molecular formula C22H34N4O3S
and a molecular weight of 434.61 g/mol. Its IUPAC name is tert-butyl 3-amino-5-[2-(4-ethylpiperazin-1-yl)ethoxy]-4,6-dimethylthieno[2,3-b]pyridine-2-carboxylate.
Molecular Properties
| Compound Name | tert-butyl 3-amino-5-[2-(4-ethylpiperazin-1-yl)ethoxy]-4,6-dimethylthieno[2,3-b]pyridine-2-carboxylate |
| PubChem CID | 45376736 |
| Molecular Formula | C22H34N4O3S |
| Molecular Weight | 434.61 g/mol |
| Exact Mass | 434.24 |
| IUPAC Name | tert-butyl 3-amino-5-[2-(4-ethylpiperazin-1-yl)ethoxy]-4,6-dimethylthieno[2,3-b]pyridine-2-carboxylate |
| SMILES | CCN1CCN(CCOc2c(C)nc3sc(C(=O)OC(C)(C)C)c(N)c3c2C)CC1 |
| InChI | InChI=1S/C22H34N4O3S/c1-7-25-8-10-26(11-9-25)12-13-28-18-14(2)16-17(23)19(21(27)29-22(4,5)6)30-20(16)24-15(18)3/h7-13,23H2,1-6H3 |
| InChIKey | AIFMTRIKMDPKLT-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 434.61 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze tert-butyl 3-amino-5-[2-(4-ethylpiperazin-1-yl)ethoxy]-4,6-dimethylthieno[2,3-b]pyridine-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl 3-amino-5-[2-(4-ethylpiperazin-1-yl)ethoxy]-4,6-dimethylthieno[2,3-b]pyridine-2-carboxylate?
The IUPAC name of tert-butyl 3-amino-5-[2-(4-ethylpiperazin-1-yl)ethoxy]-4,6-dimethylthieno[2,3-b]pyridine-2-carboxylate (CID 45376736) is tert-butyl 3-amino-5-[2-(4-ethylpiperazin-1-yl)ethoxy]-4,6-dimethylthieno[2,3-b]pyridine-2-carboxylate.
What is the SMILES notation for tert-butyl 3-amino-5-[2-(4-ethylpiperazin-1-yl)ethoxy]-4,6-dimethylthieno[2,3-b]pyridine-2-carboxylate?
The canonical SMILES for tert-butyl 3-amino-5-[2-(4-ethylpiperazin-1-yl)ethoxy]-4,6-dimethylthieno[2,3-b]pyridine-2-carboxylate is CCN1CCN(CCOc2c(C)nc3sc(C(=O)OC(C)(C)C)c(N)c3c2C)CC1.
What is the InChIKey of tert-butyl 3-amino-5-[2-(4-ethylpiperazin-1-yl)ethoxy]-4,6-dimethylthieno[2,3-b]pyridine-2-carboxylate?
The InChIKey is AIFMTRIKMDPKLT-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H34N4O3S/c1-7-25-8-10-26(11-9-25)12-13-28-18-14(2)16-17(23)19(21(27)29-22(4,5)6)30-20(16)24-15(18)3/h7-13,23H2,1-6H3.
What are the key properties of tert-butyl 3-amino-5-[2-(4-ethylpiperazin-1-yl)ethoxy]-4,6-dimethylthieno[2,3-b]pyridine-2-carboxylate?
tert-butyl 3-amino-5-[2-(4-ethylpiperazin-1-yl)ethoxy]-4,6-dimethylthieno[2,3-b]pyridine-2-carboxylate has a molecular weight of 434.61 g/mol, XLogP of 3.47, 6 rotatable bonds, 1 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 3-amino-5-[2-(4-ethylpiperazin-1-yl)ethoxy]-4,6-dimethylthieno[2,3-b]pyridine-2-carboxylate is sourced from PubChem (CID 45376736), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).