About N-butyl-2-propan-2-ylimidazo[1,2-a]pyridin-3-amine
N-butyl-2-propan-2-ylimidazo[1,2-a]pyridin-3-amine (PubChem CID 45377143) has the molecular formula C14H21N3
and a molecular weight of 231.34 g/mol. Its IUPAC name is N-butyl-2-propan-2-ylimidazo[1,2-a]pyridin-3-amine.
Molecular Properties
| Compound Name | N-butyl-2-propan-2-ylimidazo[1,2-a]pyridin-3-amine |
| PubChem CID | 45377143 |
| Molecular Formula | C14H21N3 |
| Molecular Weight | 231.34 g/mol |
| Exact Mass | 231.17 |
| IUPAC Name | N-butyl-2-propan-2-ylimidazo[1,2-a]pyridin-3-amine |
| SMILES | CCCCNc1c(C(C)C)nc2ccccn12 |
| InChI | InChI=1S/C14H21N3/c1-4-5-9-15-14-13(11(2)3)16-12-8-6-7-10-17(12)14/h6-8,10-11,15H,4-5,9H2,1-3H3 |
| InChIKey | DOHKJSTWSGZAGJ-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 29.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 231.34 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-butyl-2-propan-2-ylimidazo[1,2-a]pyridin-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-butyl-2-propan-2-ylimidazo[1,2-a]pyridin-3-amine?
The IUPAC name of N-butyl-2-propan-2-ylimidazo[1,2-a]pyridin-3-amine (CID 45377143) is N-butyl-2-propan-2-ylimidazo[1,2-a]pyridin-3-amine.
What is the SMILES notation for N-butyl-2-propan-2-ylimidazo[1,2-a]pyridin-3-amine?
The canonical SMILES for N-butyl-2-propan-2-ylimidazo[1,2-a]pyridin-3-amine is CCCCNc1c(C(C)C)nc2ccccn12.
What is the InChIKey of N-butyl-2-propan-2-ylimidazo[1,2-a]pyridin-3-amine?
The InChIKey is DOHKJSTWSGZAGJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H21N3/c1-4-5-9-15-14-13(11(2)3)16-12-8-6-7-10-17(12)14/h6-8,10-11,15H,4-5,9H2,1-3H3.
What are the key properties of N-butyl-2-propan-2-ylimidazo[1,2-a]pyridin-3-amine?
N-butyl-2-propan-2-ylimidazo[1,2-a]pyridin-3-amine has a molecular weight of 231.34 g/mol, XLogP of 3.67, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-butyl-2-propan-2-ylimidazo[1,2-a]pyridin-3-amine is sourced from PubChem (CID 45377143), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).