C24H22N4O3 — CID 45377565
ethyl 5-[5-methyl-2-(pyridin-4-ylmethylcarbamoyl)-4-pyridinyl]-1H-indole-2-carboxylate (PubChem CID 45377565) has the molecular formula C24H22N4O3 and a molecular weight of 414.47 g/mol. Its IUPAC name is ethyl 5-[5-methyl-2-(pyridin-4-ylmethylcarbamoyl)-4-pyridinyl]-1H-indole-2-carboxylate.
| Compound Name | ethyl 5-[5-methyl-2-(pyridin-4-ylmethylcarbamoyl)-4-pyridinyl]-1H-indole-2-carboxylate |
|---|---|
| PubChem CID | 45377565 |
| Molecular Formula | C24H22N4O3 |
| Molecular Weight | 414.47 g/mol |
| Exact Mass | 414.17 |
| IUPAC Name | ethyl 5-[5-methyl-2-(pyridin-4-ylmethylcarbamoyl)-4-pyridinyl]-1H-indole-2-carboxylate |
| SMILES | CCOC(=O)c1cc2cc(-c3cc(C(=O)NCc4ccncc4)ncc3C)ccc2[nH]1 |
| InChI | InChI=1S/C24H22N4O3/c1-3-31-24(30)22-11-18-10-17(4-5-20(18)28-22)19-12-21(26-13-15(19)2)23(29)27-14-16-6-8-25-9-7-16/h4-13,28H,3,14H2,1-2H3,(H,27,29) |
| InChIKey | DMKUTALHEIQGEX-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.47 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |