About ethyl 5-{5-methyl-2-[(pyridin-4-ylmethyl)carbamoyl]pyridin-4-yl}-1H-indole-2-carboxylate
ethyl 5-{5-methyl-2-[(pyridin-4-ylmethyl)carbamoyl]pyridin-4-yl}-1H-indole-2-carboxylate (PubChem CID 45377565) has the molecular formula C24H22N4O3
and a molecular weight of 414.50 g/mol. Its IUPAC name is ethyl 5-[5-methyl-2-(pyridin-4-ylmethylcarbamoyl)-4-pyridinyl]-1H-indole-2-carboxylate.
Molecular Properties
| Compound Name | ethyl 5-{5-methyl-2-[(pyridin-4-ylmethyl)carbamoyl]pyridin-4-yl}-1H-indole-2-carboxylate |
| PubChem CID | 45377565 |
| Molecular Formula | C24H22N4O3 |
| Molecular Weight | 414.50 g/mol |
| Exact Mass | 414.17 |
| IUPAC Name | ethyl 5-[5-methyl-2-(pyridin-4-ylmethylcarbamoyl)-4-pyridinyl]-1H-indole-2-carboxylate |
| SMILES | CCOC(=O)C1=CC2=C(N1)C=CC(=C2)C3=CC(=NC=C3C)C(=O)NCC4=CC=NC=C4 |
| InChI | InChI=1S/C24H22N4O3/c1-3-31-24(30)22-11-18-10-17(4-5-20(18)28-22)19-12-21(26-13-15(19)2)23(29)27-14-16-6-8-25-9-7-16/h4-13,28H,3,14H2,1-2H3,(H,27,29) |
| InChIKey | DMKUTALHEIQGEX-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 97.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | 624 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 414.50 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze ethyl 5-{5-methyl-2-[(pyridin-4-ylmethyl)carbamoyl]pyridin-4-yl}-1H-indole-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 5-{5-methyl-2-[(pyridin-4-ylmethyl)carbamoyl]pyridin-4-yl}-1H-indole-2-carboxylate?
The IUPAC name of ethyl 5-{5-methyl-2-[(pyridin-4-ylmethyl)carbamoyl]pyridin-4-yl}-1H-indole-2-carboxylate (CID 45377565) is ethyl 5-[5-methyl-2-(pyridin-4-ylmethylcarbamoyl)-4-pyridinyl]-1H-indole-2-carboxylate.
What is the SMILES notation for ethyl 5-{5-methyl-2-[(pyridin-4-ylmethyl)carbamoyl]pyridin-4-yl}-1H-indole-2-carboxylate?
The canonical SMILES for ethyl 5-{5-methyl-2-[(pyridin-4-ylmethyl)carbamoyl]pyridin-4-yl}-1H-indole-2-carboxylate is CCOC(=O)C1=CC2=C(N1)C=CC(=C2)C3=CC(=NC=C3C)C(=O)NCC4=CC=NC=C4.
What is the InChIKey of ethyl 5-{5-methyl-2-[(pyridin-4-ylmethyl)carbamoyl]pyridin-4-yl}-1H-indole-2-carboxylate?
The InChIKey is DMKUTALHEIQGEX-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H22N4O3/c1-3-31-24(30)22-11-18-10-17(4-5-20(18)28-22)19-12-21(26-13-15(19)2)23(29)27-14-16-6-8-25-9-7-16/h4-13,28H,3,14H2,1-2H3,(H,27,29).
What are the key properties of ethyl 5-{5-methyl-2-[(pyridin-4-ylmethyl)carbamoyl]pyridin-4-yl}-1H-indole-2-carboxylate?
ethyl 5-{5-methyl-2-[(pyridin-4-ylmethyl)carbamoyl]pyridin-4-yl}-1H-indole-2-carboxylate has a molecular weight of 414.50 g/mol, XLogP of 3.60, 7 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 5-{5-methyl-2-[(pyridin-4-ylmethyl)carbamoyl]pyridin-4-yl}-1H-indole-2-carboxylate is sourced from PubChem (CID 45377565), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).