C28H23F4N5O3 — CID 45377721
(2S,4R)-N-[4-(4-fluorophenoxy)phenyl]-1-[2-(1,2,4-triazol-1-yl)acetyl]-4-[(2,4,6-trifluorophenyl)methyl]pyrrolidine-2-carboxamide (PubChem CID 45377721) has the molecular formula C28H23F4N5O3 and a molecular weight of 553.52 g/mol. Its IUPAC name is (2S,4R)-N-[4-(4-fluorophenoxy)phenyl]-1-[2-(1,2,4-triazol-1-yl)acetyl]-4-[(2,4,6-trifluorophenyl)methyl]pyrrolidine-2-carboxamide.
| Compound Name | (2S,4R)-N-[4-(4-fluorophenoxy)phenyl]-1-[2-(1,2,4-triazol-1-yl)acetyl]-4-[(2,4,6-trifluorophenyl)methyl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 45377721 |
| Molecular Formula | C28H23F4N5O3 |
| Molecular Weight | 553.52 g/mol |
| Exact Mass | 553.17 |
| IUPAC Name | (2S,4R)-N-[4-(4-fluorophenoxy)phenyl]-1-[2-(1,2,4-triazol-1-yl)acetyl]-4-[(2,4,6-trifluorophenyl)methyl]pyrrolidine-2-carboxamide |
| SMILES | O=C(Nc1ccc(Oc2ccc(F)cc2)cc1)[C@@H]1C[C@@H](Cc2c(F)cc(F)cc2F)CN1C(=O)Cn1cncn1 |
| InChI | InChI=1S/C28H23F4N5O3/c29-18-1-5-21(6-2-18)40-22-7-3-20(4-8-22)35-28(39)26-10-17(9-23-24(31)11-19(30)12-25(23)32)13-37(26)27(38)14-36-16-33-15-34-36/h1-8,11-12,15-17,26H,9-10,13-14H2,(H,35,39)/t17-,26+/m1/s1 |
| InChIKey | CQKLVORUYIFUKM-QUGAMOGWSA-N |
| XLogP | 4.73 |
| TPSA | 89.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.52 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |