C22H23N5O8 — CID 45377904
[(2R,3R,4R,5R)-3,4-diacetyloxy-5-[6-(3-hydroxyanilino)purin-9-yl]oxolan-2-yl]methyl acetate (PubChem CID 45377904) has the molecular formula C22H23N5O8 and a molecular weight of 485.45 g/mol. Its IUPAC name is [(2R,3R,4R,5R)-3,4-diacetyloxy-5-[6-(3-hydroxyanilino)purin-9-yl]oxolan-2-yl]methyl acetate.
| Compound Name | [(2R,3R,4R,5R)-3,4-diacetyloxy-5-[6-(3-hydroxyanilino)purin-9-yl]oxolan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 45377904 |
| Molecular Formula | C22H23N5O8 |
| Molecular Weight | 485.45 g/mol |
| Exact Mass | 485.15 |
| IUPAC Name | [(2R,3R,4R,5R)-3,4-diacetyloxy-5-[6-(3-hydroxyanilino)purin-9-yl]oxolan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1O[C@@H](n2cnc3c(Nc4cccc(O)c4)ncnc32)[C@H](OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C22H23N5O8/c1-11(28)32-8-16-18(33-12(2)29)19(34-13(3)30)22(35-16)27-10-25-17-20(23-9-24-21(17)27)26-14-5-4-6-15(31)7-14/h4-7,9-10,16,18-19,22,31H,8H2,1-3H3,(H,23,24,26)/t16-,18-,19-,22-/m1/s1 |
| InChIKey | IUDLPZTURGVXEA-WGQQHEPDSA-N |
| XLogP | 1.60 |
| TPSA | 163.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.45 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|