C13H20N2O4S — CID 45378229
1-ethyl-6,7-dimethoxy-3,4-dihydro-1H-isoquinoline-2-sulfonamide (PubChem CID 45378229) has the molecular formula C13H20N2O4S and a molecular weight of 300.38 g/mol. Its IUPAC name is 1-ethyl-6,7-dimethoxy-3,4-dihydro-1H-isoquinoline-2-sulfonamide.
| Compound Name | 1-ethyl-6,7-dimethoxy-3,4-dihydro-1H-isoquinoline-2-sulfonamide |
|---|---|
| PubChem CID | 45378229 |
| Molecular Formula | C13H20N2O4S |
| Molecular Weight | 300.38 g/mol |
| Exact Mass | 300.11 |
| IUPAC Name | 1-ethyl-6,7-dimethoxy-3,4-dihydro-1H-isoquinoline-2-sulfonamide |
| SMILES | CCC1c2cc(OC)c(OC)cc2CCN1S(N)(=O)=O |
| InChI | InChI=1S/C13H20N2O4S/c1-4-11-10-8-13(19-3)12(18-2)7-9(10)5-6-15(11)20(14,16)17/h7-8,11H,4-6H2,1-3H3,(H2,14,16,17) |
| InChIKey | ZUCPDEDAEDZYCF-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 81.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.38 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |