C38H65NO6 — CID 45378462
(2S,3S,4R,5R,6R)-1,2-bis[5-(1-adamantylmethoxy)pentyl]-6-(hydroxymethyl)piperidine-3,4,5-triol (PubChem CID 45378462) has the molecular formula C38H65NO6 and a molecular weight of 631.94 g/mol. Its IUPAC name is (2S,3S,4R,5R,6R)-1,2-bis[5-(1-adamantylmethoxy)pentyl]-6-(hydroxymethyl)piperidine-3,4,5-triol.
| Compound Name | (2S,3S,4R,5R,6R)-1,2-bis[5-(1-adamantylmethoxy)pentyl]-6-(hydroxymethyl)piperidine-3,4,5-triol |
|---|---|
| PubChem CID | 45378462 |
| Molecular Formula | C38H65NO6 |
| Molecular Weight | 631.94 g/mol |
| Exact Mass | 631.48 |
| IUPAC Name | (2S,3S,4R,5R,6R)-1,2-bis[5-(1-adamantylmethoxy)pentyl]-6-(hydroxymethyl)piperidine-3,4,5-triol |
| SMILES | OC[C@@H]1[C@@H](O)[C@H](O)[C@@H](O)[C@H](CCCCCOCC23CC4CC(CC(C4)C2)C3)N1CCCCCOCC12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C38H65NO6/c40-23-33-35(42)36(43)34(41)32(7-3-1-5-9-44-24-37-17-26-11-27(18-37)13-28(12-26)19-37)39(33)8-4-2-6-10-45-25-38-20-29-14-30(21-38)16-31(15-29)22-38/h26-36,40-43H,1-25H2/t26?,27?,28?,29?,30?,31?,32-,33+,34-,35+,36+,37?,38?/m0/s1 |
| InChIKey | RMRJNSFQERLLDU-IJPSMYRMSA-N |
| XLogP | 5.31 |
| TPSA | 102.62 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 631.94 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|