C22H30O6 — CID 45378681
(1S,3R,5S,7R,9R,10R,15R,16R,20R)-10-hydroxy-7,16-bis(hydroxymethyl)-16,20-dimethyl-4,8-dioxahexacyclo[10.8.0.03,5.03,10.07,9.015,20]icos-12-en-6-one (PubChem CID 45378681) has the molecular formula C22H30O6 and a molecular weight of 390.48 g/mol. Its IUPAC name is (1S,3R,5S,7R,9R,10R,15R,16R,20R)-10-hydroxy-7,16-bis(hydroxymethyl)-16,20-dimethyl-4,8-dioxahexacyclo[10.8.0.03,5.03,10.07,9.015,20]icos-12-en-6-one.
| Compound Name | (1S,3R,5S,7R,9R,10R,15R,16R,20R)-10-hydroxy-7,16-bis(hydroxymethyl)-16,20-dimethyl-4,8-dioxahexacyclo[10.8.0.03,5.03,10.07,9.015,20]icos-12-en-6-one |
|---|---|
| PubChem CID | 45378681 |
| Molecular Formula | C22H30O6 |
| Molecular Weight | 390.48 g/mol |
| Exact Mass | 390.20 |
| IUPAC Name | (1S,3R,5S,7R,9R,10R,15R,16R,20R)-10-hydroxy-7,16-bis(hydroxymethyl)-16,20-dimethyl-4,8-dioxahexacyclo[10.8.0.03,5.03,10.07,9.015,20]icos-12-en-6-one |
| SMILES | C[C@@]1(CO)CCC[C@]2(C)[C@H]3C[C@@]45O[C@@H]4C(=O)[C@]4(CO)O[C@@H]4[C@]5(O)CC3=CC[C@@H]12 |
| InChI | InChI=1S/C22H30O6/c1-18(10-23)6-3-7-19(2)13-9-22-16(27-22)15(25)20(11-24)17(28-20)21(22,26)8-12(13)4-5-14(18)19/h4,13-14,16-17,23-24,26H,3,5-11H2,1-2H3/t13-,14-,16+,17-,18-,19+,20-,21+,22+/m0/s1 |
| InChIKey | KBWXJBCGMHNWPD-KPXXVMRZSA-N |
| XLogP | 1.11 |
| TPSA | 102.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.48 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|