C19H25N7O3 — CID 45379222
1-[4-(4,6-dimorpholin-4-yl-1,3,5-triazin-2-yl)phenyl]-3-methylurea (PubChem CID 45379222) has the molecular formula C19H25N7O3 and a molecular weight of 399.46 g/mol. Its IUPAC name is 1-[4-(4,6-dimorpholin-4-yl-1,3,5-triazin-2-yl)phenyl]-3-methylurea.
| Compound Name | 1-[4-(4,6-dimorpholin-4-yl-1,3,5-triazin-2-yl)phenyl]-3-methylurea |
|---|---|
| PubChem CID | 45379222 |
| Molecular Formula | C19H25N7O3 |
| Molecular Weight | 399.46 g/mol |
| Exact Mass | 399.20 |
| IUPAC Name | 1-[4-(4,6-dimorpholin-4-yl-1,3,5-triazin-2-yl)phenyl]-3-methylurea |
| SMILES | CNC(=O)Nc1ccc(-c2nc(N3CCOCC3)nc(N3CCOCC3)n2)cc1 |
| InChI | InChI=1S/C19H25N7O3/c1-20-19(27)21-15-4-2-14(3-5-15)16-22-17(25-6-10-28-11-7-25)24-18(23-16)26-8-12-29-13-9-26/h2-5H,6-13H2,1H3,(H2,20,21,27) |
| InChIKey | NRYFQFHSRDGWAS-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 104.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.46 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |