C17H15F6IO3S — CID 45379265
trifluoromethanesulfonate;[3-(trifluoromethyl)phenyl]-(2,4,6-trimethylphenyl)iodanium (PubChem CID 45379265) has the molecular formula C17H15F6IO3S and a molecular weight of 540.26 g/mol. Its IUPAC name is trifluoromethanesulfonate;[3-(trifluoromethyl)phenyl]-(2,4,6-trimethylphenyl)iodanium.
| Compound Name | trifluoromethanesulfonate;[3-(trifluoromethyl)phenyl]-(2,4,6-trimethylphenyl)iodanium |
|---|---|
| PubChem CID | 45379265 |
| Molecular Formula | C17H15F6IO3S |
| Molecular Weight | 540.26 g/mol |
| Exact Mass | 539.97 |
| IUPAC Name | trifluoromethanesulfonate;[3-(trifluoromethyl)phenyl]-(2,4,6-trimethylphenyl)iodanium |
| SMILES | Cc1cc(C)c([I+]c2cccc(C(F)(F)F)c2)c(C)c1.O=S(=O)([O-])C(F)(F)F |
| InChI | InChI=1S/C16H15F3I.CHF3O3S/c1-10-7-11(2)15(12(3)8-10)20-14-6-4-5-13(9-14)16(17,18)19;2-1(3,4)8(5,6)7/h4-9H,1-3H3;(H,5,6,7)/q+1;/p-1 |
| InChIKey | FKQZCCNYTGBVPK-UHFFFAOYSA-M |
| XLogP | 1.81 |
| TPSA | 57.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.26 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|