About CID 45379272
CID 45379272 (PubChem CID 45379272) has the molecular formula C24H16ClF3P
and a molecular weight of 427.81 g/mol.
Molecular Properties
| Compound Name | CID 45379272 |
| PubChem CID | 45379272 |
| Molecular Formula | C24H16ClF3P |
| Molecular Weight | 427.81 g/mol |
| Exact Mass | 427.06 |
| IUPAC Name | — |
| SMILES | FC(F)(F)c1ccc(Cl)c(-c2ccc(P([C]3[CH][CH][CH][CH]3)c3ccccc3)cc2)c1 |
| InChI | InChI=1S/C24H16ClF3P/c25-23-15-12-18(24(26,27)28)16-22(23)17-10-13-21(14-11-17)29(20-8-4-5-9-20)19-6-2-1-3-7-19/h1-16H |
| InChIKey | DRPFPWIFCZZLIT-UHFFFAOYSA-N |
| XLogP | 6.82 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 427.81 |
| LogP ≤ 5 | 6.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze CID 45379272 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 45379272?
The IUPAC name of CID 45379272 (CID 45379272) is not available.
What is the SMILES notation for CID 45379272?
The canonical SMILES for CID 45379272 is FC(F)(F)c1ccc(Cl)c(-c2ccc(P([C]3[CH][CH][CH][CH]3)c3ccccc3)cc2)c1.
What is the InChIKey of CID 45379272?
The InChIKey is DRPFPWIFCZZLIT-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H16ClF3P/c25-23-15-12-18(24(26,27)28)16-22(23)17-10-13-21(14-11-17)29(20-8-4-5-9-20)19-6-2-1-3-7-19/h1-16H.
What are the key properties of CID 45379272?
CID 45379272 has a molecular weight of 427.81 g/mol, XLogP of 6.82, 4 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for CID 45379272 is sourced from PubChem (CID 45379272), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).