About 2-anilino-5,7-dihydropyrimido[5,4-d][1]benzazepin-6-one
2-anilino-5,7-dihydropyrimido[5,4-d][1]benzazepin-6-one (PubChem CID 45379344) has the molecular formula C18H14N4O
and a molecular weight of 302.34 g/mol. Its IUPAC name is 2-anilino-5,7-dihydropyrimido[5,4-d][1]benzazepin-6-one.
Molecular Properties
| Compound Name | 2-anilino-5,7-dihydropyrimido[5,4-d][1]benzazepin-6-one |
| PubChem CID | 45379344 |
| Molecular Formula | C18H14N4O |
| Molecular Weight | 302.34 g/mol |
| Exact Mass | 302.12 |
| IUPAC Name | 2-anilino-5,7-dihydropyrimido[5,4-d][1]benzazepin-6-one |
| SMILES | O=C1Cc2cnc(Nc3ccccc3)nc2-c2ccccc2N1 |
| InChI | InChI=1S/C18H14N4O/c23-16-10-12-11-19-18(20-13-6-2-1-3-7-13)22-17(12)14-8-4-5-9-15(14)21-16/h1-9,11H,10H2,(H,21,23)(H,19,20,22) |
| InChIKey | IAKSXYZIQGVUIF-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 302.34 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-anilino-5,7-dihydropyrimido[5,4-d][1]benzazepin-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-anilino-5,7-dihydropyrimido[5,4-d][1]benzazepin-6-one?
The IUPAC name of 2-anilino-5,7-dihydropyrimido[5,4-d][1]benzazepin-6-one (CID 45379344) is 2-anilino-5,7-dihydropyrimido[5,4-d][1]benzazepin-6-one.
What is the SMILES notation for 2-anilino-5,7-dihydropyrimido[5,4-d][1]benzazepin-6-one?
The canonical SMILES for 2-anilino-5,7-dihydropyrimido[5,4-d][1]benzazepin-6-one is O=C1Cc2cnc(Nc3ccccc3)nc2-c2ccccc2N1.
What is the InChIKey of 2-anilino-5,7-dihydropyrimido[5,4-d][1]benzazepin-6-one?
The InChIKey is IAKSXYZIQGVUIF-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H14N4O/c23-16-10-12-11-19-18(20-13-6-2-1-3-7-13)22-17(12)14-8-4-5-9-15(14)21-16/h1-9,11H,10H2,(H,21,23)(H,19,20,22).
What are the key properties of 2-anilino-5,7-dihydropyrimido[5,4-d][1]benzazepin-6-one?
2-anilino-5,7-dihydropyrimido[5,4-d][1]benzazepin-6-one has a molecular weight of 302.34 g/mol, XLogP of 3.38, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-anilino-5,7-dihydropyrimido[5,4-d][1]benzazepin-6-one is sourced from PubChem (CID 45379344), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).