About 2-(4-iodoanilino)-5,7-dihydropyrimido[5,4-d][1]benzazepin-6-one
2-(4-iodoanilino)-5,7-dihydropyrimido[5,4-d][1]benzazepin-6-one (PubChem CID 45379345) has the molecular formula C18H13IN4O
and a molecular weight of 428.23 g/mol. Its IUPAC name is 2-(4-iodoanilino)-5,7-dihydropyrimido[5,4-d][1]benzazepin-6-one.
Molecular Properties
| Compound Name | 2-(4-iodoanilino)-5,7-dihydropyrimido[5,4-d][1]benzazepin-6-one |
| PubChem CID | 45379345 |
| Molecular Formula | C18H13IN4O |
| Molecular Weight | 428.23 g/mol |
| Exact Mass | 428.01 |
| IUPAC Name | 2-(4-iodoanilino)-5,7-dihydropyrimido[5,4-d][1]benzazepin-6-one |
| SMILES | O=C1Cc2cnc(Nc3ccc(I)cc3)nc2-c2ccccc2N1 |
| InChI | InChI=1S/C18H13IN4O/c19-12-5-7-13(8-6-12)21-18-20-10-11-9-16(24)22-15-4-2-1-3-14(15)17(11)23-18/h1-8,10H,9H2,(H,22,24)(H,20,21,23) |
| InChIKey | WTINBRGDWRUTBK-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 428.23 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 2-(4-iodoanilino)-5,7-dihydropyrimido[5,4-d][1]benzazepin-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-iodoanilino)-5,7-dihydropyrimido[5,4-d][1]benzazepin-6-one?
The IUPAC name of 2-(4-iodoanilino)-5,7-dihydropyrimido[5,4-d][1]benzazepin-6-one (CID 45379345) is 2-(4-iodoanilino)-5,7-dihydropyrimido[5,4-d][1]benzazepin-6-one.
What is the SMILES notation for 2-(4-iodoanilino)-5,7-dihydropyrimido[5,4-d][1]benzazepin-6-one?
The canonical SMILES for 2-(4-iodoanilino)-5,7-dihydropyrimido[5,4-d][1]benzazepin-6-one is O=C1Cc2cnc(Nc3ccc(I)cc3)nc2-c2ccccc2N1.
What is the InChIKey of 2-(4-iodoanilino)-5,7-dihydropyrimido[5,4-d][1]benzazepin-6-one?
The InChIKey is WTINBRGDWRUTBK-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H13IN4O/c19-12-5-7-13(8-6-12)21-18-20-10-11-9-16(24)22-15-4-2-1-3-14(15)17(11)23-18/h1-8,10H,9H2,(H,22,24)(H,20,21,23).
What are the key properties of 2-(4-iodoanilino)-5,7-dihydropyrimido[5,4-d][1]benzazepin-6-one?
2-(4-iodoanilino)-5,7-dihydropyrimido[5,4-d][1]benzazepin-6-one has a molecular weight of 428.23 g/mol, XLogP of 3.99, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-iodoanilino)-5,7-dihydropyrimido[5,4-d][1]benzazepin-6-one is sourced from PubChem (CID 45379345), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).