C17H32N4O3 — CID 45379587
tert-butyl 5-(3-methoxypropylamino)-1,4,9-triazaspiro[5.5]undec-4-ene-9-carboxylate (PubChem CID 45379587) has the molecular formula C17H32N4O3 and a molecular weight of 340.47 g/mol. Its IUPAC name is tert-butyl 5-(3-methoxypropylamino)-1,4,9-triazaspiro[5.5]undec-4-ene-9-carboxylate.
| Compound Name | tert-butyl 5-(3-methoxypropylamino)-1,4,9-triazaspiro[5.5]undec-4-ene-9-carboxylate |
|---|---|
| PubChem CID | 45379587 |
| Molecular Formula | C17H32N4O3 |
| Molecular Weight | 340.47 g/mol |
| Exact Mass | 340.25 |
| IUPAC Name | tert-butyl 5-(3-methoxypropylamino)-1,4,9-triazaspiro[5.5]undec-4-ene-9-carboxylate |
| SMILES | COCCCNC1=NCCNC12CCN(C(=O)OC(C)(C)C)CC2 |
| InChI | InChI=1S/C17H32N4O3/c1-16(2,3)24-15(22)21-11-6-17(7-12-21)14(19-9-10-20-17)18-8-5-13-23-4/h20H,5-13H2,1-4H3,(H,18,19) |
| InChIKey | JZWYHTOZGLPVAX-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 75.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.47 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|