C32H45N3O7 — CID 45379615
[(3R,5S)-1-[(2S)-2-(2,2-dimethylhex-5-enoxycarbonylamino)-3,3-dimethylbutanoyl]-5-methoxycarbonylpyrrolidin-3-yl] 4-ethenyl-1,3-dihydroisoindole-2-carboxylate (PubChem CID 45379615) has the molecular formula C32H45N3O7 and a molecular weight of 583.73 g/mol. Its IUPAC name is [(3R,5S)-1-[(2S)-2-(2,2-dimethylhex-5-enoxycarbonylamino)-3,3-dimethylbutanoyl]-5-methoxycarbonylpyrrolidin-3-yl] 4-ethenyl-1,3-dihydroisoindole-2-carboxylate.
| Compound Name | [(3R,5S)-1-[(2S)-2-(2,2-dimethylhex-5-enoxycarbonylamino)-3,3-dimethylbutanoyl]-5-methoxycarbonylpyrrolidin-3-yl] 4-ethenyl-1,3-dihydroisoindole-2-carboxylate |
|---|---|
| PubChem CID | 45379615 |
| Molecular Formula | C32H45N3O7 |
| Molecular Weight | 583.73 g/mol |
| Exact Mass | 583.33 |
| IUPAC Name | [(3R,5S)-1-[(2S)-2-(2,2-dimethylhex-5-enoxycarbonylamino)-3,3-dimethylbutanoyl]-5-methoxycarbonylpyrrolidin-3-yl] 4-ethenyl-1,3-dihydroisoindole-2-carboxylate |
| SMILES | C=CCCC(C)(C)COC(=O)N[C@H](C(=O)N1C[C@H](OC(=O)N2Cc3cccc(C=C)c3C2)C[C@H]1C(=O)OC)C(C)(C)C |
| InChI | InChI=1S/C32H45N3O7/c1-9-11-15-32(6,7)20-41-29(38)33-26(31(3,4)5)27(36)35-18-23(16-25(35)28(37)40-8)42-30(39)34-17-22-14-12-13-21(10-2)24(22)19-34/h9-10,12-14,23,25-26H,1-2,11,15-20H2,3-8H3,(H,33,38)/t23-,25+,26-/m1/s1 |
| InChIKey | HMJRKSIWJOMSFB-DMTNHVFBSA-N |
| XLogP | 5.06 |
| TPSA | 114.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.73 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|