C16H23N3O — CID 45379695
N-(2-methoxyethyl)spiro[2,3-dihydro-1H-pyrazine-6,3'-2,4-dihydro-1H-naphthalene]-5-amine (PubChem CID 45379695) has the molecular formula C16H23N3O and a molecular weight of 273.38 g/mol. Its IUPAC name is N-(2-methoxyethyl)spiro[2,3-dihydro-1H-pyrazine-6,3'-2,4-dihydro-1H-naphthalene]-5-amine.
| Compound Name | N-(2-methoxyethyl)spiro[2,3-dihydro-1H-pyrazine-6,3'-2,4-dihydro-1H-naphthalene]-5-amine |
|---|---|
| PubChem CID | 45379695 |
| Molecular Formula | C16H23N3O |
| Molecular Weight | 273.38 g/mol |
| Exact Mass | 273.18 |
| IUPAC Name | N-(2-methoxyethyl)spiro[2,3-dihydro-1H-pyrazine-6,3'-2,4-dihydro-1H-naphthalene]-5-amine |
| SMILES | COCCNC1=NCCNC12CCc1ccccc1C2 |
| InChI | InChI=1S/C16H23N3O/c1-20-11-10-18-15-16(19-9-8-17-15)7-6-13-4-2-3-5-14(13)12-16/h2-5,19H,6-12H2,1H3,(H,17,18) |
| InChIKey | XICGUYRLXWIGMV-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 45.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.38 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|