About 6-bromo-2,4,7-trichloroquinazoline
6-bromo-2,4,7-trichloroquinazoline (PubChem CID 45379709) has the molecular formula C8H2BrCl3N2
and a molecular weight of 312.38 g/mol. Its IUPAC name is 6-bromo-2,4,7-trichloroquinazoline.
Molecular Properties
| Compound Name | 6-bromo-2,4,7-trichloroquinazoline |
| PubChem CID | 45379709 |
| Molecular Formula | C8H2BrCl3N2 |
| Molecular Weight | 312.38 g/mol |
| Exact Mass | 309.85 |
| IUPAC Name | 6-bromo-2,4,7-trichloroquinazoline |
| SMILES | Clc1nc(Cl)c2cc(Br)c(Cl)cc2n1 |
| InChI | InChI=1S/C8H2BrCl3N2/c9-4-1-3-6(2-5(4)10)13-8(12)14-7(3)11/h1-2H |
| InChIKey | JYDYPKQCICPGSM-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 312.38 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 6-bromo-2,4,7-trichloroquinazoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-bromo-2,4,7-trichloroquinazoline?
The IUPAC name of 6-bromo-2,4,7-trichloroquinazoline (CID 45379709) is 6-bromo-2,4,7-trichloroquinazoline.
What is the SMILES notation for 6-bromo-2,4,7-trichloroquinazoline?
The canonical SMILES for 6-bromo-2,4,7-trichloroquinazoline is Clc1nc(Cl)c2cc(Br)c(Cl)cc2n1.
What is the InChIKey of 6-bromo-2,4,7-trichloroquinazoline?
The InChIKey is JYDYPKQCICPGSM-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H2BrCl3N2/c9-4-1-3-6(2-5(4)10)13-8(12)14-7(3)11/h1-2H.
What are the key properties of 6-bromo-2,4,7-trichloroquinazoline?
6-bromo-2,4,7-trichloroquinazoline has a molecular weight of 312.38 g/mol, XLogP of 4.35, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-bromo-2,4,7-trichloroquinazoline is sourced from PubChem (CID 45379709), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).