C18H15N5O2 — CID 45379714
4-(4-methoxyanilino)-3,5,10,14-tetrazatricyclo[9.4.0.02,7]pentadeca-1(11),2,4,6,12,14-hexaen-9-one (PubChem CID 45379714) has the molecular formula C18H15N5O2 and a molecular weight of 333.35 g/mol. Its IUPAC name is 4-(4-methoxyanilino)-3,5,10,14-tetrazatricyclo[9.4.0.02,7]pentadeca-1(11),2,4,6,12,14-hexaen-9-one.
| Compound Name | 4-(4-methoxyanilino)-3,5,10,14-tetrazatricyclo[9.4.0.02,7]pentadeca-1(11),2,4,6,12,14-hexaen-9-one |
|---|---|
| PubChem CID | 45379714 |
| Molecular Formula | C18H15N5O2 |
| Molecular Weight | 333.35 g/mol |
| Exact Mass | 333.12 |
| IUPAC Name | 4-(4-methoxyanilino)-3,5,10,14-tetrazatricyclo[9.4.0.02,7]pentadeca-1(11),2,4,6,12,14-hexaen-9-one |
| SMILES | COc1ccc(Nc2ncc3c(n2)-c2cnccc2NC(=O)C3)cc1 |
| InChI | InChI=1S/C18H15N5O2/c1-25-13-4-2-12(3-5-13)21-18-20-9-11-8-16(24)22-15-6-7-19-10-14(15)17(11)23-18/h2-7,9-10H,8H2,1H3,(H,22,24)(H,20,21,23) |
| InChIKey | VFARZUBCMCBSIY-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 89.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.35 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |