C19H17N5O2 — CID 45379716
4-(4-ethoxyanilino)-3,5,10,14-tetrazatricyclo[9.4.0.02,7]pentadeca-1(11),2,4,6,12,14-hexaen-9-one (PubChem CID 45379716) has the molecular formula C19H17N5O2 and a molecular weight of 347.38 g/mol. Its IUPAC name is 4-(4-ethoxyanilino)-3,5,10,14-tetrazatricyclo[9.4.0.02,7]pentadeca-1(11),2,4,6,12,14-hexaen-9-one.
| Compound Name | 4-(4-ethoxyanilino)-3,5,10,14-tetrazatricyclo[9.4.0.02,7]pentadeca-1(11),2,4,6,12,14-hexaen-9-one |
|---|---|
| PubChem CID | 45379716 |
| Molecular Formula | C19H17N5O2 |
| Molecular Weight | 347.38 g/mol |
| Exact Mass | 347.14 |
| IUPAC Name | 4-(4-ethoxyanilino)-3,5,10,14-tetrazatricyclo[9.4.0.02,7]pentadeca-1(11),2,4,6,12,14-hexaen-9-one |
| SMILES | CCOc1ccc(Nc2ncc3c(n2)-c2cnccc2NC(=O)C3)cc1 |
| InChI | InChI=1S/C19H17N5O2/c1-2-26-14-5-3-13(4-6-14)22-19-21-10-12-9-17(25)23-16-7-8-20-11-15(16)18(12)24-19/h3-8,10-11H,2,9H2,1H3,(H,23,25)(H,21,22,24) |
| InChIKey | CMNMWXJPOUQMBC-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 89.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.38 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |