C21H37NO4 — CID 45379774
(2R,3S,4S,5R)-2-[5-(1-adamantylmethoxy)pentyl]piperidine-3,4,5-triol (PubChem CID 45379774) has the molecular formula C21H37NO4 and a molecular weight of 367.53 g/mol. Its IUPAC name is (2R,3S,4S,5R)-2-[5-(1-adamantylmethoxy)pentyl]piperidine-3,4,5-triol.
| Compound Name | (2R,3S,4S,5R)-2-[5-(1-adamantylmethoxy)pentyl]piperidine-3,4,5-triol |
|---|---|
| PubChem CID | 45379774 |
| Molecular Formula | C21H37NO4 |
| Molecular Weight | 367.53 g/mol |
| Exact Mass | 367.27 |
| IUPAC Name | (2R,3S,4S,5R)-2-[5-(1-adamantylmethoxy)pentyl]piperidine-3,4,5-triol |
| SMILES | O[C@@H]1[C@@H](O)[C@@H](CCCCCOCC23CC4CC(CC(C4)C2)C3)NC[C@H]1O |
| InChI | InChI=1S/C21H37NO4/c23-18-12-22-17(19(24)20(18)25)4-2-1-3-5-26-13-21-9-14-6-15(10-21)8-16(7-14)11-21/h14-20,22-25H,1-13H2/t14?,15?,16?,17-,18-,19+,20+,21?/m1/s1 |
| InChIKey | DSUJWPNNYYUONL-WJYXQZPZSA-N |
| XLogP | 1.83 |
| TPSA | 81.95 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.53 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|