C13H16Br2N2O — CID 45379800
4-[(2-amino-3,5-dibromophenyl)methylideneamino](1,2,3,4,5,6-14C6)cyclohexan-1-ol (PubChem CID 45379800) has the molecular formula C13H16Br2N2O and a molecular weight of 388.05 g/mol. Its IUPAC name is 4-[(2-amino-3,5-dibromophenyl)methylideneamino](1,2,3,4,5,6-14C6)cyclohexan-1-ol.
| Compound Name | 4-[(2-amino-3,5-dibromophenyl)methylideneamino](1,2,3,4,5,6-14C6)cyclohexan-1-ol |
|---|---|
| PubChem CID | 45379800 |
| Molecular Formula | C13H16Br2N2O |
| Molecular Weight | 388.05 g/mol |
| Exact Mass | 385.98 |
| IUPAC Name | 4-[(2-amino-3,5-dibromophenyl)methylideneamino](1,2,3,4,5,6-14C6)cyclohexan-1-ol |
| SMILES | Nc1c(Br)cc(Br)cc1/C=N/[14CH]1[14CH2][14CH2][14CH](O)[14CH2][14CH2]1 |
| InChI | InChI=1S/C13H16Br2N2O/c14-9-5-8(13(16)12(15)6-9)7-17-10-1-3-11(18)4-2-10/h5-7,10-11,18H,1-4,16H2/b17-7+/i1+2,2+2,3+2,4+2,10+2,11+2 |
| InChIKey | PACIGGABLPTEDO-VNIYZAKCSA-N |
| XLogP | 3.52 |
| TPSA | 58.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.05 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|