C18H21ClN6O2S — CID 45379809
3-[2-[[6-chloro-2-(4-methylpiperazin-1-yl)quinazolin-4-yl]amino]ethyl]-1,3-thiazolidine-2,4-dione (PubChem CID 45379809) has the molecular formula C18H21ClN6O2S and a molecular weight of 420.93 g/mol. Its IUPAC name is 3-[2-[[6-chloro-2-(4-methylpiperazin-1-yl)quinazolin-4-yl]amino]ethyl]-1,3-thiazolidine-2,4-dione.
| Compound Name | 3-[2-[[6-chloro-2-(4-methylpiperazin-1-yl)quinazolin-4-yl]amino]ethyl]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 45379809 |
| Molecular Formula | C18H21ClN6O2S |
| Molecular Weight | 420.93 g/mol |
| Exact Mass | 420.11 |
| IUPAC Name | 3-[2-[[6-chloro-2-(4-methylpiperazin-1-yl)quinazolin-4-yl]amino]ethyl]-1,3-thiazolidine-2,4-dione |
| SMILES | CN1CCN(c2nc(NCCN3C(=O)CSC3=O)c3cc(Cl)ccc3n2)CC1 |
| InChI | InChI=1S/C18H21ClN6O2S/c1-23-6-8-24(9-7-23)17-21-14-3-2-12(19)10-13(14)16(22-17)20-4-5-25-15(26)11-28-18(25)27/h2-3,10H,4-9,11H2,1H3,(H,20,21,22) |
| InChIKey | JCUJHXGSSHVHTO-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 81.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.93 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|