C30H41N3O7 — CID 45379819
methyl (1R,12E,21S,24S)-21-tert-butyl-16,16-dimethyl-3,19,22-trioxo-2,18-dioxa-4,20,23-triazatetracyclo[21.2.1.14,7.06,11]heptacosa-6,8,10,12-tetraene-24-carboxylate (PubChem CID 45379819) has the molecular formula C30H41N3O7 and a molecular weight of 555.67 g/mol. Its IUPAC name is methyl (1R,12E,21S,24S)-21-tert-butyl-16,16-dimethyl-3,19,22-trioxo-2,18-dioxa-4,20,23-triazatetracyclo[21.2.1.14,7.06,11]heptacosa-6,8,10,12-tetraene-24-carboxylate.
| Compound Name | methyl (1R,12E,21S,24S)-21-tert-butyl-16,16-dimethyl-3,19,22-trioxo-2,18-dioxa-4,20,23-triazatetracyclo[21.2.1.14,7.06,11]heptacosa-6,8,10,12-tetraene-24-carboxylate |
|---|---|
| PubChem CID | 45379819 |
| Molecular Formula | C30H41N3O7 |
| Molecular Weight | 555.67 g/mol |
| Exact Mass | 555.29 |
| IUPAC Name | methyl (1R,12E,21S,24S)-21-tert-butyl-16,16-dimethyl-3,19,22-trioxo-2,18-dioxa-4,20,23-triazatetracyclo[21.2.1.14,7.06,11]heptacosa-6,8,10,12-tetraene-24-carboxylate |
| SMILES | COC(=O)[C@@H]1C[C@@H]2CN1C(=O)[C@H](C(C)(C)C)NC(=O)OCC(C)(C)CC/C=C\c1cccc3c1CN(C3)C(=O)O2 |
| InChI | InChI=1S/C30H41N3O7/c1-29(2,3)24-25(34)33-16-21(14-23(33)26(35)38-6)40-28(37)32-15-20-12-9-11-19(22(20)17-32)10-7-8-13-30(4,5)18-39-27(36)31-24/h7,9-12,21,23-24H,8,13-18H2,1-6H3,(H,31,36)/b10-7-/t21-,23+,24-/m1/s1 |
| InChIKey | ZJESMCISILSLBM-FCKIKQPVSA-N |
| XLogP | 4.26 |
| TPSA | 114.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.67 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|