C16H13Cl3N4O2S — CID 45380169
N-phenyl-2-[(2,6,7-trichloroquinazolin-4-yl)amino]ethanesulfonamide (PubChem CID 45380169) has the molecular formula C16H13Cl3N4O2S and a molecular weight of 431.73 g/mol. Its IUPAC name is N-phenyl-2-[(2,6,7-trichloroquinazolin-4-yl)amino]ethanesulfonamide.
| Compound Name | N-phenyl-2-[(2,6,7-trichloroquinazolin-4-yl)amino]ethanesulfonamide |
|---|---|
| PubChem CID | 45380169 |
| Molecular Formula | C16H13Cl3N4O2S |
| Molecular Weight | 431.73 g/mol |
| Exact Mass | 429.98 |
| IUPAC Name | N-phenyl-2-[(2,6,7-trichloroquinazolin-4-yl)amino]ethanesulfonamide |
| SMILES | O=S(=O)(CCNc1nc(Cl)nc2cc(Cl)c(Cl)cc12)Nc1ccccc1 |
| InChI | InChI=1S/C16H13Cl3N4O2S/c17-12-8-11-14(9-13(12)18)21-16(19)22-15(11)20-6-7-26(24,25)23-10-4-2-1-3-5-10/h1-5,8-9,23H,6-7H2,(H,20,21,22) |
| InChIKey | IYPMTBUSDLROAE-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.73 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |