C19H27NO3 — CID 45380436
4,4,6,6,7,7,8,11,11b-nonadeuterio-9-methoxy-3-(2-methylpropyl)-10-(trideuteriomethoxy)-1,3-dihydrobenzo[a]quinolizin-2-one (PubChem CID 45380436) has the molecular formula C19H27NO3 and a molecular weight of 329.50 g/mol. Its IUPAC name is 4,4,6,6,7,7,8,11,11b-nonadeuterio-9-methoxy-3-(2-methylpropyl)-10-(trideuteriomethoxy)-1,3-dihydrobenzo[a]quinolizin-2-one.
| Compound Name | 4,4,6,6,7,7,8,11,11b-nonadeuterio-9-methoxy-3-(2-methylpropyl)-10-(trideuteriomethoxy)-1,3-dihydrobenzo[a]quinolizin-2-one |
|---|---|
| PubChem CID | 45380436 |
| Molecular Formula | C19H27NO3 |
| Molecular Weight | 329.50 g/mol |
| Exact Mass | 329.27 |
| IUPAC Name | 4,4,6,6,7,7,8,11,11b-nonadeuterio-9-methoxy-3-(2-methylpropyl)-10-(trideuteriomethoxy)-1,3-dihydrobenzo[a]quinolizin-2-one |
| SMILES | [2H]c1c(OC([2H])([2H])[2H])c(OC)c([2H])c2c1C1([2H])CC(=O)C(CC(C)C)C([2H])([2H])N1C([2H])([2H])C2([2H])[2H] |
| InChI | InChI=1S/C19H27NO3/c1-12(2)7-14-11-20-6-5-13-8-18(22-3)19(23-4)9-15(13)16(20)10-17(14)21/h8-9,12,14,16H,5-7,10-11H2,1-4H3/i4D3,5D2,6D2,8D,9D,11D2,16D |
| InChIKey | MKJIEFSOBYUXJB-PWCVYCMXSA-N |
| XLogP | 3.24 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.50 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |