C23H29N3 — CID 45380483
(2R,10S)-7-methyl-3-[2-(6-methyl-3-pyridinyl)ethyl]-3,12-diazatetracyclo[10.2.2.02,10.04,9]hexadeca-4(9),5,7-triene (PubChem CID 45380483) has the molecular formula C23H29N3 and a molecular weight of 347.51 g/mol. Its IUPAC name is (2R,10S)-7-methyl-3-[2-(6-methyl-3-pyridinyl)ethyl]-3,12-diazatetracyclo[10.2.2.02,10.04,9]hexadeca-4(9),5,7-triene.
| Compound Name | (2R,10S)-7-methyl-3-[2-(6-methyl-3-pyridinyl)ethyl]-3,12-diazatetracyclo[10.2.2.02,10.04,9]hexadeca-4(9),5,7-triene |
|---|---|
| PubChem CID | 45380483 |
| Molecular Formula | C23H29N3 |
| Molecular Weight | 347.51 g/mol |
| Exact Mass | 347.24 |
| IUPAC Name | (2R,10S)-7-methyl-3-[2-(6-methyl-3-pyridinyl)ethyl]-3,12-diazatetracyclo[10.2.2.02,10.04,9]hexadeca-4(9),5,7-triene |
| SMILES | Cc1ccc2c(c1)[C@H]1CN3CCC(CC3)[C@H]1N2CCc1ccc(C)nc1 |
| InChI | InChI=1S/C23H29N3/c1-16-3-6-22-20(13-16)21-15-25-10-8-19(9-11-25)23(21)26(22)12-7-18-5-4-17(2)24-14-18/h3-6,13-14,19,21,23H,7-12,15H2,1-2H3/t21-,23-/m1/s1 |
| InChIKey | MXPTYNVDHZINDO-FYYLOGMGSA-N |
| XLogP | 3.94 |
| TPSA | 19.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.51 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |