C22H33FO5S — CID 45380613
7-[(1R,2R,3R,5S)-2-[(3R)-4-(2-fluorophenyl)sulfanyl-3-hydroxybutyl]-3,5-dihydroxycyclopentyl]heptanoic acid (PubChem CID 45380613) has the molecular formula C22H33FO5S and a molecular weight of 428.57 g/mol. Its IUPAC name is 7-[(1R,2R,3R,5S)-2-[(3R)-4-(2-fluorophenyl)sulfanyl-3-hydroxybutyl]-3,5-dihydroxycyclopentyl]heptanoic acid.
| Compound Name | 7-[(1R,2R,3R,5S)-2-[(3R)-4-(2-fluorophenyl)sulfanyl-3-hydroxybutyl]-3,5-dihydroxycyclopentyl]heptanoic acid |
|---|---|
| PubChem CID | 45380613 |
| Molecular Formula | C22H33FO5S |
| Molecular Weight | 428.57 g/mol |
| Exact Mass | 428.20 |
| IUPAC Name | 7-[(1R,2R,3R,5S)-2-[(3R)-4-(2-fluorophenyl)sulfanyl-3-hydroxybutyl]-3,5-dihydroxycyclopentyl]heptanoic acid |
| SMILES | O=C(O)CCCCCC[C@@H]1[C@@H](CC[C@@H](O)CSc2ccccc2F)[C@H](O)C[C@@H]1O |
| InChI | InChI=1S/C22H33FO5S/c23-18-8-5-6-9-21(18)29-14-15(24)11-12-17-16(19(25)13-20(17)26)7-3-1-2-4-10-22(27)28/h5-6,8-9,15-17,19-20,24-26H,1-4,7,10-14H2,(H,27,28)/t15-,16-,17-,19+,20-/m1/s1 |
| InChIKey | QUKPIZUVCZLSFZ-RISVGRPXSA-N |
| XLogP | 3.84 |
| TPSA | 97.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.57 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|