About 2-[(2,4-dichlorophenyl)methyl]-5-hexyl-4-phenyl-1H-imidazole
2-[(2,4-dichlorophenyl)methyl]-5-hexyl-4-phenyl-1H-imidazole (PubChem CID 45380632) has the molecular formula C22H24Cl2N2
and a molecular weight of 387.35 g/mol. Its IUPAC name is 2-[(2,4-dichlorophenyl)methyl]-5-hexyl-4-phenyl-1H-imidazole.
Molecular Properties
| Compound Name | 2-[(2,4-dichlorophenyl)methyl]-5-hexyl-4-phenyl-1H-imidazole |
| PubChem CID | 45380632 |
| Molecular Formula | C22H24Cl2N2 |
| Molecular Weight | 387.35 g/mol |
| Exact Mass | 386.13 |
| IUPAC Name | 2-[(2,4-dichlorophenyl)methyl]-5-hexyl-4-phenyl-1H-imidazole |
| SMILES | CCCCCCc1[nH]c(Cc2ccc(Cl)cc2Cl)nc1-c1ccccc1 |
| InChI | InChI=1S/C22H24Cl2N2/c1-2-3-4-8-11-20-22(16-9-6-5-7-10-16)26-21(25-20)14-17-12-13-18(23)15-19(17)24/h5-7,9-10,12-13,15H,2-4,8,11,14H2,1H3,(H,25,26) |
| InChIKey | ZMUCHMSMYCICNZ-UHFFFAOYSA-N |
| XLogP | 7.10 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 387.35 |
| LogP ≤ 5 | 7.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-[(2,4-dichlorophenyl)methyl]-5-hexyl-4-phenyl-1H-imidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(2,4-dichlorophenyl)methyl]-5-hexyl-4-phenyl-1H-imidazole?
The IUPAC name of 2-[(2,4-dichlorophenyl)methyl]-5-hexyl-4-phenyl-1H-imidazole (CID 45380632) is 2-[(2,4-dichlorophenyl)methyl]-5-hexyl-4-phenyl-1H-imidazole.
What is the SMILES notation for 2-[(2,4-dichlorophenyl)methyl]-5-hexyl-4-phenyl-1H-imidazole?
The canonical SMILES for 2-[(2,4-dichlorophenyl)methyl]-5-hexyl-4-phenyl-1H-imidazole is CCCCCCc1[nH]c(Cc2ccc(Cl)cc2Cl)nc1-c1ccccc1.
What is the InChIKey of 2-[(2,4-dichlorophenyl)methyl]-5-hexyl-4-phenyl-1H-imidazole?
The InChIKey is ZMUCHMSMYCICNZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H24Cl2N2/c1-2-3-4-8-11-20-22(16-9-6-5-7-10-16)26-21(25-20)14-17-12-13-18(23)15-19(17)24/h5-7,9-10,12-13,15H,2-4,8,11,14H2,1H3,(H,25,26).
What are the key properties of 2-[(2,4-dichlorophenyl)methyl]-5-hexyl-4-phenyl-1H-imidazole?
2-[(2,4-dichlorophenyl)methyl]-5-hexyl-4-phenyl-1H-imidazole has a molecular weight of 387.35 g/mol, XLogP of 7.10, 8 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(2,4-dichlorophenyl)methyl]-5-hexyl-4-phenyl-1H-imidazole is sourced from PubChem (CID 45380632), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).