C21H16ClN5O2 — CID 45380769
5-(6-chloro-3-pyridinyl)-3-(2-methylphenyl)-3,4,9,10-tetrazatricyclo[7.3.0.02,6]dodeca-1(12),2(6),4,10-tetraene-11-carboxylic acid (PubChem CID 45380769) has the molecular formula C21H16ClN5O2 and a molecular weight of 405.85 g/mol. Its IUPAC name is 5-(6-chloro-3-pyridinyl)-3-(2-methylphenyl)-3,4,9,10-tetrazatricyclo[7.3.0.02,6]dodeca-1(12),2(6),4,10-tetraene-11-carboxylic acid.
| Compound Name | 5-(6-chloro-3-pyridinyl)-3-(2-methylphenyl)-3,4,9,10-tetrazatricyclo[7.3.0.02,6]dodeca-1(12),2(6),4,10-tetraene-11-carboxylic acid |
|---|---|
| PubChem CID | 45380769 |
| Molecular Formula | C21H16ClN5O2 |
| Molecular Weight | 405.85 g/mol |
| Exact Mass | 405.10 |
| IUPAC Name | 5-(6-chloro-3-pyridinyl)-3-(2-methylphenyl)-3,4,9,10-tetrazatricyclo[7.3.0.02,6]dodeca-1(12),2(6),4,10-tetraene-11-carboxylic acid |
| SMILES | Cc1ccccc1-n1nc(-c2ccc(Cl)nc2)c2c1-c1cc(C(=O)O)nn1CC2 |
| InChI | InChI=1S/C21H16ClN5O2/c1-12-4-2-3-5-16(12)27-20-14(19(25-27)13-6-7-18(22)23-11-13)8-9-26-17(20)10-15(24-26)21(28)29/h2-7,10-11H,8-9H2,1H3,(H,28,29) |
| InChIKey | RSEGNWZDJIAMKD-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 85.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.85 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|