C17H16ClN5O2 — CID 45380771
5-(6-chloro-3-pyridinyl)-3-propan-2-yl-3,4,9,10-tetrazatricyclo[7.3.0.02,6]dodeca-1(12),2(6),4,10-tetraene-11-carboxylic acid (PubChem CID 45380771) has the molecular formula C17H16ClN5O2 and a molecular weight of 357.80 g/mol. Its IUPAC name is 5-(6-chloro-3-pyridinyl)-3-propan-2-yl-3,4,9,10-tetrazatricyclo[7.3.0.02,6]dodeca-1(12),2(6),4,10-tetraene-11-carboxylic acid.
| Compound Name | 5-(6-chloro-3-pyridinyl)-3-propan-2-yl-3,4,9,10-tetrazatricyclo[7.3.0.02,6]dodeca-1(12),2(6),4,10-tetraene-11-carboxylic acid |
|---|---|
| PubChem CID | 45380771 |
| Molecular Formula | C17H16ClN5O2 |
| Molecular Weight | 357.80 g/mol |
| Exact Mass | 357.10 |
| IUPAC Name | 5-(6-chloro-3-pyridinyl)-3-propan-2-yl-3,4,9,10-tetrazatricyclo[7.3.0.02,6]dodeca-1(12),2(6),4,10-tetraene-11-carboxylic acid |
| SMILES | CC(C)n1nc(-c2ccc(Cl)nc2)c2c1-c1cc(C(=O)O)nn1CC2 |
| InChI | InChI=1S/C17H16ClN5O2/c1-9(2)23-16-11(15(21-23)10-3-4-14(18)19-8-10)5-6-22-13(16)7-12(20-22)17(24)25/h3-4,7-9H,5-6H2,1-2H3,(H,24,25) |
| InChIKey | RYXBJXUPUMJXLU-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 85.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.80 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|