C25H23FN4O5S — CID 45381334
(5S)-5-[2-[(5-fluoro-3-hydroxy-11-oxo-1-azatricyclo[6.3.1.04,12]dodeca-4,6,8(12),9-tetraen-3-yl)methylamino]ethyl]-3-(3-oxo-4H-1,4-benzothiazin-6-yl)-1,3-oxazolidin-2-one (PubChem CID 45381334) has the molecular formula C25H23FN4O5S and a molecular weight of 510.55 g/mol. Its IUPAC name is (5S)-5-[2-[(5-fluoro-3-hydroxy-11-oxo-1-azatricyclo[6.3.1.04,12]dodeca-4,6,8(12),9-tetraen-3-yl)methylamino]ethyl]-3-(3-oxo-4H-1,4-benzothiazin-6-yl)-1,3-oxazolidin-2-one.
| Compound Name | (5S)-5-[2-[(5-fluoro-3-hydroxy-11-oxo-1-azatricyclo[6.3.1.04,12]dodeca-4,6,8(12),9-tetraen-3-yl)methylamino]ethyl]-3-(3-oxo-4H-1,4-benzothiazin-6-yl)-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 45381334 |
| Molecular Formula | C25H23FN4O5S |
| Molecular Weight | 510.55 g/mol |
| Exact Mass | 510.14 |
| IUPAC Name | (5S)-5-[2-[(5-fluoro-3-hydroxy-11-oxo-1-azatricyclo[6.3.1.04,12]dodeca-4,6,8(12),9-tetraen-3-yl)methylamino]ethyl]-3-(3-oxo-4H-1,4-benzothiazin-6-yl)-1,3-oxazolidin-2-one |
| SMILES | O=C1CSc2ccc(N3C[C@H](CCNCC4(O)Cn5c(=O)ccc6ccc(F)c4c65)OC3=O)cc2N1 |
| InChI | InChI=1S/C25H23FN4O5S/c26-17-4-1-14-2-6-21(32)30-13-25(34,22(17)23(14)30)12-27-8-7-16-10-29(24(33)35-16)15-3-5-19-18(9-15)28-20(31)11-36-19/h1-6,9,16,27,34H,7-8,10-13H2,(H,28,31)/t16-,25?/m0/s1 |
| InChIKey | RQWGCITZSISLBY-YPHZTSLFSA-N |
| XLogP | 2.39 |
| TPSA | 112.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.55 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|