C18H18FN5O5 — CID 45381703
(4'R,6'S,7'S)-13'-amino-17'-fluoro-4',6'-dimethylspiro[1,3-diazinane-5,8'-5,15-dioxa-2,14-diazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(17),10,12(16),13-tetraene]-2,4,6-trione (PubChem CID 45381703) has the molecular formula C18H18FN5O5 and a molecular weight of 403.37 g/mol. Its IUPAC name is (4'R,6'S,7'S)-13'-amino-17'-fluoro-4',6'-dimethylspiro[1,3-diazinane-5,8'-5,15-dioxa-2,14-diazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(17),10,12(16),13-tetraene]-2,4,6-trione.
| Compound Name | (4'R,6'S,7'S)-13'-amino-17'-fluoro-4',6'-dimethylspiro[1,3-diazinane-5,8'-5,15-dioxa-2,14-diazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(17),10,12(16),13-tetraene]-2,4,6-trione |
|---|---|
| PubChem CID | 45381703 |
| Molecular Formula | C18H18FN5O5 |
| Molecular Weight | 403.37 g/mol |
| Exact Mass | 403.13 |
| IUPAC Name | (4'R,6'S,7'S)-13'-amino-17'-fluoro-4',6'-dimethylspiro[1,3-diazinane-5,8'-5,15-dioxa-2,14-diazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(17),10,12(16),13-tetraene]-2,4,6-trione |
| SMILES | C[C@@H]1CN2c3c(cc4c(N)noc4c3F)CC3(C(=O)NC(=O)NC3=O)[C@H]2[C@H](C)O1 |
| InChI | InChI=1S/C18H18FN5O5/c1-6-5-24-11-8(3-9-12(10(11)19)29-23-14(9)20)4-18(13(24)7(2)28-6)15(25)21-17(27)22-16(18)26/h3,6-7,13H,4-5H2,1-2H3,(H2,20,23)(H2,21,22,25,26,27)/t6-,7+,13-/m1/s1 |
| InChIKey | SBWCMUMKNBMKNA-DDZXGWPLSA-N |
| XLogP | 0.44 |
| TPSA | 139.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.37 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|