C15H5F3N2O2S — CID 45381838
2-(4-cyano-5,7,8-trifluoronaphthalen-2-yl)-1,3-thiazole-5-carboxylic acid (PubChem CID 45381838) has the molecular formula C15H5F3N2O2S and a molecular weight of 334.28 g/mol. Its IUPAC name is 2-(4-cyano-5,7,8-trifluoronaphthalen-2-yl)-1,3-thiazole-5-carboxylic acid.
| Compound Name | 2-(4-cyano-5,7,8-trifluoronaphthalen-2-yl)-1,3-thiazole-5-carboxylic acid |
|---|---|
| PubChem CID | 45381838 |
| Molecular Formula | C15H5F3N2O2S |
| Molecular Weight | 334.28 g/mol |
| Exact Mass | 334.00 |
| IUPAC Name | 2-(4-cyano-5,7,8-trifluoronaphthalen-2-yl)-1,3-thiazole-5-carboxylic acid |
| SMILES | N#Cc1cc(-c2ncc(C(=O)O)s2)cc2c(F)c(F)cc(F)c12 |
| InChI | InChI=1S/C15H5F3N2O2S/c16-9-3-10(17)13(18)8-2-6(1-7(4-19)12(8)9)14-20-5-11(23-14)15(21)22/h1-3,5H,(H,21,22) |
| InChIKey | ISHFCZSZUVCEOA-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 73.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.28 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|