C24H29N5O3 — CID 45381939
1-[(3-methoxyphenyl)methyl]-3-[4-(1H-pyrazol-4-yl)-2-(2-pyrrolidin-1-ylethoxy)phenyl]urea (PubChem CID 45381939) has the molecular formula C24H29N5O3 and a molecular weight of 435.53 g/mol. Its IUPAC name is 1-[(3-methoxyphenyl)methyl]-3-[4-(1H-pyrazol-4-yl)-2-(2-pyrrolidin-1-ylethoxy)phenyl]urea.
| Compound Name | 1-[(3-methoxyphenyl)methyl]-3-[4-(1H-pyrazol-4-yl)-2-(2-pyrrolidin-1-ylethoxy)phenyl]urea |
|---|---|
| PubChem CID | 45381939 |
| Molecular Formula | C24H29N5O3 |
| Molecular Weight | 435.53 g/mol |
| Exact Mass | 435.23 |
| IUPAC Name | 1-[(3-methoxyphenyl)methyl]-3-[4-(1H-pyrazol-4-yl)-2-(2-pyrrolidin-1-ylethoxy)phenyl]urea |
| SMILES | COc1cccc(CNC(=O)Nc2ccc(-c3cn[nH]c3)cc2OCCN2CCCC2)c1 |
| InChI | InChI=1S/C24H29N5O3/c1-31-21-6-4-5-18(13-21)15-25-24(30)28-22-8-7-19(20-16-26-27-17-20)14-23(22)32-12-11-29-9-2-3-10-29/h4-8,13-14,16-17H,2-3,9-12,15H2,1H3,(H,26,27)(H2,25,28,30) |
| InChIKey | BRTDWPMOELAWOU-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 91.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.53 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |