C15H19N4O+ — CID 45382305
12-methoxy-5,7-dimethyl-3-propyl-4,8,13-triaza-2-azoniatricyclo[7.4.0.02,6]trideca-1(9),2,5,7,10,12-hexaene (PubChem CID 45382305) has the molecular formula C15H19N4O+ and a molecular weight of 271.34 g/mol. Its IUPAC name is 12-methoxy-5,7-dimethyl-3-propyl-4,8,13-triaza-2-azoniatricyclo[7.4.0.02,6]trideca-1(9),2,5,7,10,12-hexaene.
| Compound Name | 12-methoxy-5,7-dimethyl-3-propyl-4,8,13-triaza-2-azoniatricyclo[7.4.0.02,6]trideca-1(9),2,5,7,10,12-hexaene |
|---|---|
| PubChem CID | 45382305 |
| Molecular Formula | C15H19N4O+ |
| Molecular Weight | 271.34 g/mol |
| Exact Mass | 271.16 |
| IUPAC Name | 12-methoxy-5,7-dimethyl-3-propyl-4,8,13-triaza-2-azoniatricyclo[7.4.0.02,6]trideca-1(9),2,5,7,10,12-hexaene |
| SMILES | CCCc1[nH]c(C)c2c(C)nc3ccc(OC)nc3[n+]12 |
| InChI | InChI=1S/C15H18N4O/c1-5-6-12-17-10(3)14-9(2)16-11-7-8-13(20-4)18-15(11)19(12)14/h7-8H,5-6H2,1-4H3/p+1 |
| InChIKey | YNADXFWEXJTQSZ-UHFFFAOYSA-O |
| XLogP | 2.27 |
| TPSA | 54.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.34 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|