C17H20N4O4 — CID 4539174
N-[(2,3,4-trimethoxyphenyl)methylideneamino]-1,4,5,6-tetrahydrocyclopenta[d]pyrazole-3-carboxamide (PubChem CID 4539174) has the molecular formula C17H20N4O4 and a molecular weight of 344.37 g/mol. Its IUPAC name is N-[(2,3,4-trimethoxyphenyl)methylideneamino]-1,4,5,6-tetrahydrocyclopenta[d]pyrazole-3-carboxamide.
| Compound Name | N-[(2,3,4-trimethoxyphenyl)methylideneamino]-1,4,5,6-tetrahydrocyclopenta[d]pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 4539174 |
| Molecular Formula | C17H20N4O4 |
| Molecular Weight | 344.37 g/mol |
| Exact Mass | 344.15 |
| IUPAC Name | N-[(2,3,4-trimethoxyphenyl)methylideneamino]-1,4,5,6-tetrahydrocyclopenta[d]pyrazole-3-carboxamide |
| SMILES | COc1ccc(C=NNC(=O)c2n[nH]c3c2CCC3)c(OC)c1OC |
| InChI | InChI=1S/C17H20N4O4/c1-23-13-8-7-10(15(24-2)16(13)25-3)9-18-21-17(22)14-11-5-4-6-12(11)19-20-14/h7-9H,4-6H2,1-3H3,(H,19,20)(H,21,22) |
| InChIKey | LAODQEOCZAYNTA-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 97.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.37 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|