C20H22N2O2S — CID 4539271
7'-hydroxy-4,4-dimethyl-2'-phenylspiro[1,3-diazinane-6,4'-2,3-dihydrochromene]-2-thione (PubChem CID 4539271) has the molecular formula C20H22N2O2S and a molecular weight of 354.48 g/mol. Its IUPAC name is 7'-hydroxy-4,4-dimethyl-2'-phenylspiro[1,3-diazinane-6,4'-2,3-dihydrochromene]-2-thione.
| Compound Name | 7'-hydroxy-4,4-dimethyl-2'-phenylspiro[1,3-diazinane-6,4'-2,3-dihydrochromene]-2-thione |
|---|---|
| PubChem CID | 4539271 |
| Molecular Formula | C20H22N2O2S |
| Molecular Weight | 354.48 g/mol |
| Exact Mass | 354.14 |
| IUPAC Name | 7'-hydroxy-4,4-dimethyl-2'-phenylspiro[1,3-diazinane-6,4'-2,3-dihydrochromene]-2-thione |
| SMILES | CC1(C)CC2(CC(c3ccccc3)Oc3cc(O)ccc32)NC(=S)N1 |
| InChI | InChI=1S/C20H22N2O2S/c1-19(2)12-20(22-18(25)21-19)11-17(13-6-4-3-5-7-13)24-16-10-14(23)8-9-15(16)20/h3-10,17,23H,11-12H2,1-2H3,(H2,21,22,25) |
| InChIKey | LRBROLUCYAUOSF-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 53.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.48 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|