About 1-(benzenesulfonyl)-N-(1,3-thiazol-2-yl)piperidine-2-carboxamide
1-(benzenesulfonyl)-N-(1,3-thiazol-2-yl)piperidine-2-carboxamide (PubChem CID 4539654) has the molecular formula C15H17N3O3S2
and a molecular weight of 351.45 g/mol. Its IUPAC name is 1-(benzenesulfonyl)-N-(1,3-thiazol-2-yl)piperidine-2-carboxamide.
Molecular Properties
| Compound Name | 1-(benzenesulfonyl)-N-(1,3-thiazol-2-yl)piperidine-2-carboxamide |
| PubChem CID | 4539654 |
| Molecular Formula | C15H17N3O3S2 |
| Molecular Weight | 351.45 g/mol |
| Exact Mass | 351.07 |
| IUPAC Name | 1-(benzenesulfonyl)-N-(1,3-thiazol-2-yl)piperidine-2-carboxamide |
| SMILES | O=C(Nc1nccs1)C1CCCCN1S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C15H17N3O3S2/c19-14(17-15-16-9-11-22-15)13-8-4-5-10-18(13)23(20,21)12-6-2-1-3-7-12/h1-3,6-7,9,11,13H,4-5,8,10H2,(H,16,17,19) |
| InChIKey | NVJAWQBHBQTEPV-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 351.45 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-(benzenesulfonyl)-N-(1,3-thiazol-2-yl)piperidine-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(benzenesulfonyl)-N-(1,3-thiazol-2-yl)piperidine-2-carboxamide?
The IUPAC name of 1-(benzenesulfonyl)-N-(1,3-thiazol-2-yl)piperidine-2-carboxamide (CID 4539654) is 1-(benzenesulfonyl)-N-(1,3-thiazol-2-yl)piperidine-2-carboxamide.
What is the SMILES notation for 1-(benzenesulfonyl)-N-(1,3-thiazol-2-yl)piperidine-2-carboxamide?
The canonical SMILES for 1-(benzenesulfonyl)-N-(1,3-thiazol-2-yl)piperidine-2-carboxamide is O=C(Nc1nccs1)C1CCCCN1S(=O)(=O)c1ccccc1.
What is the InChIKey of 1-(benzenesulfonyl)-N-(1,3-thiazol-2-yl)piperidine-2-carboxamide?
The InChIKey is NVJAWQBHBQTEPV-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H17N3O3S2/c19-14(17-15-16-9-11-22-15)13-8-4-5-10-18(13)23(20,21)12-6-2-1-3-7-12/h1-3,6-7,9,11,13H,4-5,8,10H2,(H,16,17,19).
What are the key properties of 1-(benzenesulfonyl)-N-(1,3-thiazol-2-yl)piperidine-2-carboxamide?
1-(benzenesulfonyl)-N-(1,3-thiazol-2-yl)piperidine-2-carboxamide has a molecular weight of 351.45 g/mol, XLogP of 2.33, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(benzenesulfonyl)-N-(1,3-thiazol-2-yl)piperidine-2-carboxamide is sourced from PubChem (CID 4539654), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).