About 4-(dibromomethyl)-3,4-dimethylcyclohexa-2,5-dien-1-one
4-(dibromomethyl)-3,4-dimethylcyclohexa-2,5-dien-1-one (PubChem CID 4539699) has the molecular formula C9H10Br2O
and a molecular weight of 293.99 g/mol. Its IUPAC name is 4-(dibromomethyl)-3,4-dimethylcyclohexa-2,5-dien-1-one.
Molecular Properties
| Compound Name | 4-(dibromomethyl)-3,4-dimethylcyclohexa-2,5-dien-1-one |
| PubChem CID | 4539699 |
| Molecular Formula | C9H10Br2O |
| Molecular Weight | 293.99 g/mol |
| Exact Mass | 291.91 |
| IUPAC Name | 4-(dibromomethyl)-3,4-dimethylcyclohexa-2,5-dien-1-one |
| SMILES | CC1=CC(=O)C=CC1(C)C(Br)Br |
| InChI | InChI=1S/C9H10Br2O/c1-6-5-7(12)3-4-9(6,2)8(10)11/h3-5,8H,1-2H3 |
| InChIKey | CUOYKTCVSWPXCL-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 293.99 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 4-(dibromomethyl)-3,4-dimethylcyclohexa-2,5-dien-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(dibromomethyl)-3,4-dimethylcyclohexa-2,5-dien-1-one?
The IUPAC name of 4-(dibromomethyl)-3,4-dimethylcyclohexa-2,5-dien-1-one (CID 4539699) is 4-(dibromomethyl)-3,4-dimethylcyclohexa-2,5-dien-1-one.
What is the SMILES notation for 4-(dibromomethyl)-3,4-dimethylcyclohexa-2,5-dien-1-one?
The canonical SMILES for 4-(dibromomethyl)-3,4-dimethylcyclohexa-2,5-dien-1-one is CC1=CC(=O)C=CC1(C)C(Br)Br.
What is the InChIKey of 4-(dibromomethyl)-3,4-dimethylcyclohexa-2,5-dien-1-one?
The InChIKey is CUOYKTCVSWPXCL-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10Br2O/c1-6-5-7(12)3-4-9(6,2)8(10)11/h3-5,8H,1-2H3.
What are the key properties of 4-(dibromomethyl)-3,4-dimethylcyclohexa-2,5-dien-1-one?
4-(dibromomethyl)-3,4-dimethylcyclohexa-2,5-dien-1-one has a molecular weight of 293.99 g/mol, XLogP of 3.19, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(dibromomethyl)-3,4-dimethylcyclohexa-2,5-dien-1-one is sourced from PubChem (CID 4539699), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).